About 5-(4-chlorophenyl)-2-(1-methylpiperidin-4-yl)pyrimidine;dioxoplatinum
5-(4-chlorophenyl)-2-(1-methylpiperidin-4-yl)pyrimidine;dioxoplatinum (PubChem CID 161025882) has the molecular formula C16H18ClN3O2Pt
and a molecular weight of 514.87 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-(1-methylpiperidin-4-yl)pyrimidine;dioxoplatinum.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-2-(1-methylpiperidin-4-yl)pyrimidine;dioxoplatinum |
| PubChem CID | 161025882 |
| Molecular Formula | C16H18ClN3O2Pt |
| Molecular Weight | 514.87 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | 5-(4-chlorophenyl)-2-(1-methylpiperidin-4-yl)pyrimidine;dioxoplatinum |
| SMILES | CN1CCC(c2ncc(-c3ccc(Cl)cc3)cn2)CC1.O=[Pt]=O |
| InChI | InChI=1S/C16H18ClN3.2O.Pt/c1-20-8-6-13(7-9-20)16-18-10-14(11-19-16)12-2-4-15(17)5-3-12;;;/h2-5,10-11,13H,6-9H2,1H3;;; |
| InChIKey | TYYUILXWJDMODW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 514.87 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(4-chlorophenyl)-2-(1-methylpiperidin-4-yl)pyrimidine;dioxoplatinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-2-(1-methylpiperidin-4-yl)pyrimidine;dioxoplatinum?
The IUPAC name of 5-(4-chlorophenyl)-2-(1-methylpiperidin-4-yl)pyrimidine;dioxoplatinum (CID 161025882) is 5-(4-chlorophenyl)-2-(1-methylpiperidin-4-yl)pyrimidine;dioxoplatinum.
What is the SMILES notation for 5-(4-chlorophenyl)-2-(1-methylpiperidin-4-yl)pyrimidine;dioxoplatinum?
The canonical SMILES for 5-(4-chlorophenyl)-2-(1-methylpiperidin-4-yl)pyrimidine;dioxoplatinum is CN1CCC(c2ncc(-c3ccc(Cl)cc3)cn2)CC1.O=[Pt]=O.
What is the InChIKey of 5-(4-chlorophenyl)-2-(1-methylpiperidin-4-yl)pyrimidine;dioxoplatinum?
The InChIKey is TYYUILXWJDMODW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClN3.2O.Pt/c1-20-8-6-13(7-9-20)16-18-10-14(11-19-16)12-2-4-15(17)5-3-12;;;/h2-5,10-11,13H,6-9H2,1H3;;;.
What are the key properties of 5-(4-chlorophenyl)-2-(1-methylpiperidin-4-yl)pyrimidine;dioxoplatinum?
5-(4-chlorophenyl)-2-(1-methylpiperidin-4-yl)pyrimidine;dioxoplatinum has a molecular weight of 514.87 g/mol, XLogP of 3.37, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-2-(1-methylpiperidin-4-yl)pyrimidine;dioxoplatinum is sourced from PubChem (CID 161025882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).