About 3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-2-ide;pyrrolidin-2-one
3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-2-ide;pyrrolidin-2-one (PubChem CID 161027016) has the molecular formula C16H14Cl2F3N2O-
and a molecular weight of 378.20 g/mol. Its IUPAC name is 3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-2-ide;pyrrolidin-2-one.
Molecular Properties
| Compound Name | 3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-2-ide;pyrrolidin-2-one |
| PubChem CID | 161027016 |
| Molecular Formula | C16H14Cl2F3N2O- |
| Molecular Weight | 378.20 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-2-ide;pyrrolidin-2-one |
| SMILES | FC(F)(F)c1cccc(-n2[c-]c(Cl)c(CCl)c2)c1.O=C1CCCN1 |
| InChI | InChI=1S/C12H7Cl2F3N.C4H7NO/c13-5-8-6-18(7-11(8)14)10-3-1-2-9(4-10)12(15,16)17;6-4-2-1-3-5-4/h1-4,6H,5H2;1-3H2,(H,5,6)/q-1; |
| InChIKey | TZCPROJDURAMFU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.20 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-2-ide;pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-2-ide;pyrrolidin-2-one?
The IUPAC name of 3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-2-ide;pyrrolidin-2-one (CID 161027016) is 3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-2-ide;pyrrolidin-2-one.
What is the SMILES notation for 3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-2-ide;pyrrolidin-2-one?
The canonical SMILES for 3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-2-ide;pyrrolidin-2-one is FC(F)(F)c1cccc(-n2[c-]c(Cl)c(CCl)c2)c1.O=C1CCCN1.
What is the InChIKey of 3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-2-ide;pyrrolidin-2-one?
The InChIKey is TZCPROJDURAMFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7Cl2F3N.C4H7NO/c13-5-8-6-18(7-11(8)14)10-3-1-2-9(4-10)12(15,16)17;6-4-2-1-3-5-4/h1-4,6H,5H2;1-3H2,(H,5,6)/q-1;.
What are the key properties of 3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-2-ide;pyrrolidin-2-one?
3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-2-ide;pyrrolidin-2-one has a molecular weight of 378.20 g/mol, XLogP of 4.58, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-(chloromethyl)-1-[3-(trifluoromethyl)phenyl]-2H-pyrrol-2-ide;pyrrolidin-2-one is sourced from PubChem (CID 161027016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).