C28H23FN4OS — CID 161028336
(5aR,6R,9aS)-3-(2-fluorophenyl)-6,9a-dimethyl-1-(5-methyl-1,3-benzothiazol-2-yl)-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile (PubChem CID 161028336) has the molecular formula C28H23FN4OS and a molecular weight of 482.58 g/mol. Its IUPAC name is (5aR,6R,9aS)-3-(2-fluorophenyl)-6,9a-dimethyl-1-(5-methyl-1,3-benzothiazol-2-yl)-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile.
| Compound Name | (5aR,6R,9aS)-3-(2-fluorophenyl)-6,9a-dimethyl-1-(5-methyl-1,3-benzothiazol-2-yl)-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 161028336 |
| Molecular Formula | C28H23FN4OS |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | (5aR,6R,9aS)-3-(2-fluorophenyl)-6,9a-dimethyl-1-(5-methyl-1,3-benzothiazol-2-yl)-7-oxo-4,5,5a,6-tetrahydrobenzo[g]indazole-8-carbonitrile |
| SMILES | Cc1ccc2sc(-n3nc(-c4ccccc4F)c4c3[C@]3(C)C=C(C#N)C(=O)[C@H](C)[C@H]3CC4)nc2c1 |
| InChI | InChI=1S/C28H23FN4OS/c1-15-8-11-23-22(12-15)31-27(35-23)33-26-19(24(32-33)18-6-4-5-7-21(18)29)9-10-20-16(2)25(34)17(14-30)13-28(20,26)3/h4-8,11-13,16,20H,9-10H2,1-3H3/t16-,20-,28-/m1/s1 |
| InChIKey | TZGZAHZXIGGTJP-FYOXXRTDSA-N |
| XLogP | 6.09 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |