C16H26F6O5 — CID 161028972
1-[2-[difluoro(propoxy)methoxy]-1,1,2,2-tetrafluoroethoxy]propane;3-(prop-2-enoxymethoxy)prop-1-ene (PubChem CID 161028972) has the molecular formula C16H26F6O5 and a molecular weight of 412.37 g/mol. Its IUPAC name is 1-[2-[difluoro(propoxy)methoxy]-1,1,2,2-tetrafluoroethoxy]propane;3-(prop-2-enoxymethoxy)prop-1-ene.
| Compound Name | 1-[2-[difluoro(propoxy)methoxy]-1,1,2,2-tetrafluoroethoxy]propane;3-(prop-2-enoxymethoxy)prop-1-ene |
|---|---|
| PubChem CID | 161028972 |
| Molecular Formula | C16H26F6O5 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 1-[2-[difluoro(propoxy)methoxy]-1,1,2,2-tetrafluoroethoxy]propane;3-(prop-2-enoxymethoxy)prop-1-ene |
| SMILES | C=CCOCOCC=C.CCCOC(F)(F)OC(F)(F)C(F)(F)OCCC |
| InChI | InChI=1S/C9H14F6O3.C7H12O2/c1-3-5-16-7(10,11)8(12,13)18-9(14,15)17-6-4-2;1-3-5-8-7-9-6-4-2/h3-6H2,1-2H3;3-4H,1-2,5-7H2 |
| InChIKey | TZIVNUIQVQZPFR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|