C8H9N5O2 — CID 161029738
4a,6,7,8-tetrahydro-1H-purino[7,8-a]pyrimidine-2,4-dione (PubChem CID 161029738) has the molecular formula C8H9N5O2 and a molecular weight of 207.19 g/mol. Its IUPAC name is 4a,6,7,8-tetrahydro-1H-purino[7,8-a]pyrimidine-2,4-dione.
| Compound Name | 4a,6,7,8-tetrahydro-1H-purino[7,8-a]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 161029738 |
| Molecular Formula | C8H9N5O2 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 4a,6,7,8-tetrahydro-1H-purino[7,8-a]pyrimidine-2,4-dione |
| SMILES | O=C1NC(=O)C2C(=NC3=NCCCN32)N1 |
| InChI | InChI=1S/C8H9N5O2/c14-6-4-5(11-8(15)12-6)10-7-9-2-1-3-13(4)7/h4H,1-3H2,(H2,9,10,11,12,14,15) |
| InChIKey | TZLHCSSUDXQCKP-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 86.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |