About pentalene;vanadium
pentalene;vanadium (PubChem CID 161032270) has the molecular formula C8H6V
and a molecular weight of 153.08 g/mol. Its IUPAC name is pentalene;vanadium.
Molecular Properties
| Compound Name | pentalene;vanadium |
| PubChem CID | 161032270 |
| Molecular Formula | C8H6V |
| Molecular Weight | 153.08 g/mol |
| Exact Mass | 152.99 |
| IUPAC Name | pentalene;vanadium |
| SMILES | C1=CC2=CC=CC2=C1.[V] |
| InChI | InChI=1S/C8H6.V/c1-3-7-5-2-6-8(7)4-1;/h1-6H; |
| InChIKey | TZTVNTKIUCXKRF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.08 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze pentalene;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentalene;vanadium?
The IUPAC name of pentalene;vanadium (CID 161032270) is pentalene;vanadium.
What is the SMILES notation for pentalene;vanadium?
The canonical SMILES for pentalene;vanadium is C1=CC2=CC=CC2=C1.[V].
What is the InChIKey of pentalene;vanadium?
The InChIKey is TZTVNTKIUCXKRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6.V/c1-3-7-5-2-6-8(7)4-1;/h1-6H;.
What are the key properties of pentalene;vanadium?
pentalene;vanadium has a molecular weight of 153.08 g/mol, XLogP of 1.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pentalene;vanadium is sourced from PubChem (CID 161032270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).