C28H39ClO6 — CID 161033419
2-(2-chloroethyl)-4-oxatricyclo[4.2.1.03,7]nonan-5-one;2-(4-methylpent-4-enyl)-4-oxatricyclo[4.2.1.03,7]nonan-5-one;2-methylprop-2-enoic acid (PubChem CID 161033419) has the molecular formula C28H39ClO6 and a molecular weight of 507.07 g/mol. Its IUPAC name is 2-(2-chloroethyl)-4-oxatricyclo[4.2.1.03,7]nonan-5-one;2-(4-methylpent-4-enyl)-4-oxatricyclo[4.2.1.03,7]nonan-5-one;2-methylprop-2-enoic acid.
| Compound Name | 2-(2-chloroethyl)-4-oxatricyclo[4.2.1.03,7]nonan-5-one;2-(4-methylpent-4-enyl)-4-oxatricyclo[4.2.1.03,7]nonan-5-one;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 161033419 |
| Molecular Formula | C28H39ClO6 |
| Molecular Weight | 507.07 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 2-(2-chloroethyl)-4-oxatricyclo[4.2.1.03,7]nonan-5-one;2-(4-methylpent-4-enyl)-4-oxatricyclo[4.2.1.03,7]nonan-5-one;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.C=C(C)CCCC1C2CC3C(=O)OC1C3C2.O=C1OC2C(CCCl)C3CC1C2C3 |
| InChI | InChI=1S/C14H20O2.C10H13ClO2.C4H6O2/c1-8(2)4-3-5-10-9-6-11-12(7-9)14(15)16-13(10)11;11-2-1-6-5-3-7-8(4-5)10(12)13-9(6)7;1-3(2)4(5)6/h9-13H,1,3-7H2,2H3;5-9H,1-4H2;1H2,2H3,(H,5,6) |
| InChIKey | TZXVIPWZZYIAOH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.07 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|