About hexafluoro-λ6-sulfane
hexafluoro-λ6-sulfane (PubChem CID 161034792) has the molecular formula F12S2
and a molecular weight of 292.11 g/mol. Its IUPAC name is hexafluoro-λ6-sulfane.
Molecular Properties
| Compound Name | hexafluoro-λ6-sulfane |
| PubChem CID | 161034792 |
| Molecular Formula | F12S2 |
| Molecular Weight | 292.11 g/mol |
| Exact Mass | 291.92 |
| IUPAC Name | hexafluoro-λ6-sulfane |
| SMILES | FS(F)(F)(F)(F)F.FS(F)(F)(F)(F)F |
| InChI | InChI=1S/2F6S/c2*1-7(2,3,4,5)6 |
| InChIKey | UACMVUUZPBXZME-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 292.11 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze hexafluoro-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexafluoro-λ6-sulfane?
The IUPAC name of hexafluoro-λ6-sulfane (CID 161034792) is hexafluoro-λ6-sulfane.
What is the SMILES notation for hexafluoro-λ6-sulfane?
The canonical SMILES for hexafluoro-λ6-sulfane is FS(F)(F)(F)(F)F.FS(F)(F)(F)(F)F.
What is the InChIKey of hexafluoro-λ6-sulfane?
The InChIKey is UACMVUUZPBXZME-UHFFFAOYSA-N. The full InChI is InChI=1S/2F6S/c2*1-7(2,3,4,5)6.
What are the key properties of hexafluoro-λ6-sulfane?
hexafluoro-λ6-sulfane has a molecular weight of 292.11 g/mol, XLogP of 6.34, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexafluoro-λ6-sulfane is sourced from PubChem (CID 161034792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).