C31H36BBrF2N4O4 — CID 161035372
tert-butyl N-[(1S)-1-(3-bromophenyl)ethyl]carbamate;(6-fluoro-3-pyridinyl)boronic acid;(1S)-1-[3-(6-fluoro-3-pyridinyl)phenyl]ethanamine (PubChem CID 161035372) has the molecular formula C31H36BBrF2N4O4 and a molecular weight of 657.37 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(3-bromophenyl)ethyl]carbamate;(6-fluoro-3-pyridinyl)boronic acid;(1S)-1-[3-(6-fluoro-3-pyridinyl)phenyl]ethanamine.
| Compound Name | tert-butyl N-[(1S)-1-(3-bromophenyl)ethyl]carbamate;(6-fluoro-3-pyridinyl)boronic acid;(1S)-1-[3-(6-fluoro-3-pyridinyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 161035372 |
| Molecular Formula | C31H36BBrF2N4O4 |
| Molecular Weight | 657.37 g/mol |
| Exact Mass | 656.20 |
| IUPAC Name | tert-butyl N-[(1S)-1-(3-bromophenyl)ethyl]carbamate;(6-fluoro-3-pyridinyl)boronic acid;(1S)-1-[3-(6-fluoro-3-pyridinyl)phenyl]ethanamine |
| SMILES | C[C@H](N)c1cccc(-c2ccc(F)nc2)c1.C[C@H](NC(=O)OC(C)(C)C)c1cccc(Br)c1.OB(O)c1ccc(F)nc1 |
| InChI | InChI=1S/C13H18BrNO2.C13H13FN2.C5H5BFNO2/c1-9(10-6-5-7-11(14)8-10)15-12(16)17-13(2,3)4;1-9(15)10-3-2-4-11(7-10)12-5-6-13(14)16-8-12;7-5-2-1-4(3-8-5)6(9)10/h5-9H,1-4H3,(H,15,16);2-9H,15H2,1H3;1-3,9-10H/t2*9-;/m00./s1 |
| InChIKey | UAEIYJXWULTDOX-NAWJVIAPSA-N |
| XLogP | 5.84 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.37 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|