About 4,5-dihydro-1H-imidazole;N-ethylprop-2-enamide
4,5-dihydro-1H-imidazole;N-ethylprop-2-enamide (PubChem CID 161035467) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is 4,5-dihydro-1H-imidazole;N-ethylprop-2-enamide.
Molecular Properties
| Compound Name | 4,5-dihydro-1H-imidazole;N-ethylprop-2-enamide |
| PubChem CID | 161035467 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 4,5-dihydro-1H-imidazole;N-ethylprop-2-enamide |
| SMILES | C1=NCCN1.C=CC(=O)NCC |
| InChI | InChI=1S/C5H9NO.C3H6N2/c1-3-5(7)6-4-2;1-2-5-3-4-1/h3H,1,4H2,2H3,(H,6,7);3H,1-2H2,(H,4,5) |
| InChIKey | UAEQZACCXHCEIK-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dihydro-1H-imidazole;N-ethylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-1H-imidazole;N-ethylprop-2-enamide?
The IUPAC name of 4,5-dihydro-1H-imidazole;N-ethylprop-2-enamide (CID 161035467) is 4,5-dihydro-1H-imidazole;N-ethylprop-2-enamide.
What is the SMILES notation for 4,5-dihydro-1H-imidazole;N-ethylprop-2-enamide?
The canonical SMILES for 4,5-dihydro-1H-imidazole;N-ethylprop-2-enamide is C1=NCCN1.C=CC(=O)NCC.
What is the InChIKey of 4,5-dihydro-1H-imidazole;N-ethylprop-2-enamide?
The InChIKey is UAEQZACCXHCEIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.C3H6N2/c1-3-5(7)6-4-2;1-2-5-3-4-1/h3H,1,4H2,2H3,(H,6,7);3H,1-2H2,(H,4,5).
What are the key properties of 4,5-dihydro-1H-imidazole;N-ethylprop-2-enamide?
4,5-dihydro-1H-imidazole;N-ethylprop-2-enamide has a molecular weight of 169.23 g/mol, XLogP of -0.07, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-1H-imidazole;N-ethylprop-2-enamide is sourced from PubChem (CID 161035467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).