C24H21N3O — CID 161035484
3-[2,5-bis(4-aminophenyl)phenoxy]aniline (PubChem CID 161035484) has the molecular formula C24H21N3O and a molecular weight of 367.45 g/mol. Its IUPAC name is 3-[2,5-bis(4-aminophenyl)phenoxy]aniline.
| Compound Name | 3-[2,5-bis(4-aminophenyl)phenoxy]aniline |
|---|---|
| PubChem CID | 161035484 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 3-[2,5-bis(4-aminophenyl)phenoxy]aniline |
| SMILES | Nc1ccc(-c2ccc(-c3ccc(N)cc3)c(Oc3cccc(N)c3)c2)cc1 |
| InChI | InChI=1S/C24H21N3O/c25-19-9-4-16(5-10-19)18-8-13-23(17-6-11-20(26)12-7-17)24(14-18)28-22-3-1-2-21(27)15-22/h1-15H,25-27H2 |
| InChIKey | UAESJFCANZJRTR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|