C22H23FN6OS — CID 161036681
(1R,2R,4R)-5-[8-ethyl-6-fluoro-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-9H-pyrimido[4,5-b]indol-4-yl]bicyclo[2.2.1]heptan-2-amine (PubChem CID 161036681) has the molecular formula C22H23FN6OS and a molecular weight of 438.53 g/mol. Its IUPAC name is (1R,2R,4R)-5-[8-ethyl-6-fluoro-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-9H-pyrimido[4,5-b]indol-4-yl]bicyclo[2.2.1]heptan-2-amine.
| Compound Name | (1R,2R,4R)-5-[8-ethyl-6-fluoro-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-9H-pyrimido[4,5-b]indol-4-yl]bicyclo[2.2.1]heptan-2-amine |
|---|---|
| PubChem CID | 161036681 |
| Molecular Formula | C22H23FN6OS |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (1R,2R,4R)-5-[8-ethyl-6-fluoro-2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-9H-pyrimido[4,5-b]indol-4-yl]bicyclo[2.2.1]heptan-2-amine |
| SMILES | CCc1cc(F)cc2c1[nH]c1nc(Sc3nnc(C)o3)nc(C3C[C@H]4C[C@@H]3C[C@H]4N)c12 |
| InChI | InChI=1S/C22H23FN6OS/c1-3-10-5-13(23)8-15-17-19(14-6-12-4-11(14)7-16(12)24)26-21(27-20(17)25-18(10)15)31-22-29-28-9(2)30-22/h5,8,11-12,14,16H,3-4,6-7,24H2,1-2H3,(H,25,26,27)/t11-,12-,14?,16-/m1/s1 |
| InChIKey | GEUNSXHRKAGPJA-NZQXWLTISA-N |
| XLogP | 4.50 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |