C40H41N3 — CID 161038141
1-methylnaphthalene;2-methylnaphthalene;2-methylpyridine;3-methylpyridine;4-methylpyridine (PubChem CID 161038141) has the molecular formula C40H41N3 and a molecular weight of 563.79 g/mol. Its IUPAC name is 1-methylnaphthalene;2-methylnaphthalene;2-methylpyridine;3-methylpyridine;4-methylpyridine.
| Compound Name | 1-methylnaphthalene;2-methylnaphthalene;2-methylpyridine;3-methylpyridine;4-methylpyridine |
|---|---|
| PubChem CID | 161038141 |
| Molecular Formula | C40H41N3 |
| Molecular Weight | 563.79 g/mol |
| Exact Mass | 563.33 |
| IUPAC Name | 1-methylnaphthalene;2-methylnaphthalene;2-methylpyridine;3-methylpyridine;4-methylpyridine |
| SMILES | Cc1ccc2ccccc2c1.Cc1cccc2ccccc12.Cc1ccccn1.Cc1cccnc1.Cc1ccncc1 |
| InChI | InChI=1S/2C11H10.3C6H7N/c1-9-5-4-7-10-6-2-3-8-11(9)10;1-9-6-7-10-4-2-3-5-11(10)8-9;1-6-2-4-7-5-3-6;1-6-3-2-4-7-5-6;1-6-4-2-3-5-7-6/h2*2-8H,1H3;3*2-5H,1H3 |
| InChIKey | UANGDLGWORFYGS-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.79 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |