C22H20F6N8O5 — CID 161038582
1H-1,2,4-triazole-5-carboxylic acid;[4-(trifluoromethoxy)phenyl]methanamine;N-[[4-(trifluoromethoxy)phenyl]methyl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 161038582) has the molecular formula C22H20F6N8O5 and a molecular weight of 590.44 g/mol. Its IUPAC name is 1H-1,2,4-triazole-5-carboxylic acid;[4-(trifluoromethoxy)phenyl]methanamine;N-[[4-(trifluoromethoxy)phenyl]methyl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 1H-1,2,4-triazole-5-carboxylic acid;[4-(trifluoromethoxy)phenyl]methanamine;N-[[4-(trifluoromethoxy)phenyl]methyl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 161038582 |
| Molecular Formula | C22H20F6N8O5 |
| Molecular Weight | 590.44 g/mol |
| Exact Mass | 590.15 |
| IUPAC Name | 1H-1,2,4-triazole-5-carboxylic acid;[4-(trifluoromethoxy)phenyl]methanamine;N-[[4-(trifluoromethoxy)phenyl]methyl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | NCc1ccc(OC(F)(F)F)cc1.O=C(NCc1ccc(OC(F)(F)F)cc1)c1ncn[nH]1.O=C(O)c1ncn[nH]1 |
| InChI | InChI=1S/C11H9F3N4O2.C8H8F3NO.C3H3N3O2/c12-11(13,14)20-8-3-1-7(2-4-8)5-15-10(19)9-16-6-17-18-9;9-8(10,11)13-7-3-1-6(5-12)2-4-7;7-3(8)2-4-1-5-6-2/h1-4,6H,5H2,(H,15,19)(H,16,17,18);1-4H,5,12H2;1H,(H,7,8)(H,4,5,6) |
| InChIKey | UAOUGULCCBNDAW-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 194.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |