About 2-(4-hexylphenyl)quinoline;iridium(3+)
2-(4-hexylphenyl)quinoline;iridium(3+) (PubChem CID 161040240) has the molecular formula C21H23IrN+3
and a molecular weight of 481.64 g/mol. Its IUPAC name is 2-(4-hexylphenyl)quinoline;iridium(3+).
Molecular Properties
| Compound Name | 2-(4-hexylphenyl)quinoline;iridium(3+) |
| PubChem CID | 161040240 |
| Molecular Formula | C21H23IrN+3 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 2-(4-hexylphenyl)quinoline;iridium(3+) |
| SMILES | CCCCCCc1ccc(-c2ccc3ccccc3n2)cc1.[Ir+3] |
| InChI | InChI=1S/C21H23N.Ir/c1-2-3-4-5-8-17-11-13-19(14-12-17)21-16-15-18-9-6-7-10-20(18)22-21;/h6-7,9-16H,2-5,8H2,1H3;/q;+3 |
| InChIKey | UAUCBBZMPQDNEI-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-hexylphenyl)quinoline;iridium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hexylphenyl)quinoline;iridium(3+)?
The IUPAC name of 2-(4-hexylphenyl)quinoline;iridium(3+) (CID 161040240) is 2-(4-hexylphenyl)quinoline;iridium(3+).
What is the SMILES notation for 2-(4-hexylphenyl)quinoline;iridium(3+)?
The canonical SMILES for 2-(4-hexylphenyl)quinoline;iridium(3+) is CCCCCCc1ccc(-c2ccc3ccccc3n2)cc1.[Ir+3].
What is the InChIKey of 2-(4-hexylphenyl)quinoline;iridium(3+)?
The InChIKey is UAUCBBZMPQDNEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N.Ir/c1-2-3-4-5-8-17-11-13-19(14-12-17)21-16-15-18-9-6-7-10-20(18)22-21;/h6-7,9-16H,2-5,8H2,1H3;/q;+3.
What are the key properties of 2-(4-hexylphenyl)quinoline;iridium(3+)?
2-(4-hexylphenyl)quinoline;iridium(3+) has a molecular weight of 481.64 g/mol, XLogP of 6.02, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hexylphenyl)quinoline;iridium(3+) is sourced from PubChem (CID 161040240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).