C32H64N8 — CID 161041138
(2,7-dicyclohexyl-7-hydrazinylocta-3,5-dien-2-yl)hydrazine;(7-hydrazinyl-2,4,5,7-tetramethylocta-3,5-dien-2-yl)hydrazine (PubChem CID 161041138) has the molecular formula C32H64N8 and a molecular weight of 560.92 g/mol. Its IUPAC name is (2,7-dicyclohexyl-7-hydrazinylocta-3,5-dien-2-yl)hydrazine;(7-hydrazinyl-2,4,5,7-tetramethylocta-3,5-dien-2-yl)hydrazine.
| Compound Name | (2,7-dicyclohexyl-7-hydrazinylocta-3,5-dien-2-yl)hydrazine;(7-hydrazinyl-2,4,5,7-tetramethylocta-3,5-dien-2-yl)hydrazine |
|---|---|
| PubChem CID | 161041138 |
| Molecular Formula | C32H64N8 |
| Molecular Weight | 560.92 g/mol |
| Exact Mass | 560.53 |
| IUPAC Name | (2,7-dicyclohexyl-7-hydrazinylocta-3,5-dien-2-yl)hydrazine;(7-hydrazinyl-2,4,5,7-tetramethylocta-3,5-dien-2-yl)hydrazine |
| SMILES | CC(=CC(C)(C)NN)C(C)=CC(C)(C)NN.CC(C=CC=CC(C)(NN)C1CCCCC1)(NN)C1CCCCC1 |
| InChI | InChI=1S/C20H38N4.C12H26N4/c1-19(23-21,17-11-5-3-6-12-17)15-9-10-16-20(2,24-22)18-13-7-4-8-14-18;1-9(7-11(3,4)15-13)10(2)8-12(5,6)16-14/h9-10,15-18,23-24H,3-8,11-14,21-22H2,1-2H3;7-8,15-16H,13-14H2,1-6H3 |
| InChIKey | UAWYXCKJRXZBDC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 152.20 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.92 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|