About (2,7-dicyclohexyl-7-hydrazinylocta-3,5-dien-2-yl)hydrazine
(2,7-dicyclohexyl-7-hydrazinylocta-3,5-dien-2-yl)hydrazine (PubChem CID 161041140) has the molecular formula C20H38N4
and a molecular weight of 334.55 g/mol. Its IUPAC name is (2,7-dicyclohexyl-7-hydrazinylocta-3,5-dien-2-yl)hydrazine.
Molecular Properties
| Compound Name | (2,7-dicyclohexyl-7-hydrazinylocta-3,5-dien-2-yl)hydrazine |
| PubChem CID | 161041140 |
| Molecular Formula | C20H38N4 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.31 |
| IUPAC Name | (2,7-dicyclohexyl-7-hydrazinylocta-3,5-dien-2-yl)hydrazine |
| SMILES | CC(C=CC=CC(C)(NN)C1CCCCC1)(NN)C1CCCCC1 |
| InChI | InChI=1S/C20H38N4/c1-19(23-21,17-11-5-3-6-12-17)15-9-10-16-20(2,24-22)18-13-7-4-8-14-18/h9-10,15-18,23-24H,3-8,11-14,21-22H2,1-2H3 |
| InChIKey | KXLUXXLFMSULPH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2,7-dicyclohexyl-7-hydrazinylocta-3,5-dien-2-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,7-dicyclohexyl-7-hydrazinylocta-3,5-dien-2-yl)hydrazine?
The IUPAC name of (2,7-dicyclohexyl-7-hydrazinylocta-3,5-dien-2-yl)hydrazine (CID 161041140) is (2,7-dicyclohexyl-7-hydrazinylocta-3,5-dien-2-yl)hydrazine.
What is the SMILES notation for (2,7-dicyclohexyl-7-hydrazinylocta-3,5-dien-2-yl)hydrazine?
The canonical SMILES for (2,7-dicyclohexyl-7-hydrazinylocta-3,5-dien-2-yl)hydrazine is CC(C=CC=CC(C)(NN)C1CCCCC1)(NN)C1CCCCC1.
What is the InChIKey of (2,7-dicyclohexyl-7-hydrazinylocta-3,5-dien-2-yl)hydrazine?
The InChIKey is KXLUXXLFMSULPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38N4/c1-19(23-21,17-11-5-3-6-12-17)15-9-10-16-20(2,24-22)18-13-7-4-8-14-18/h9-10,15-18,23-24H,3-8,11-14,21-22H2,1-2H3.
What are the key properties of (2,7-dicyclohexyl-7-hydrazinylocta-3,5-dien-2-yl)hydrazine?
(2,7-dicyclohexyl-7-hydrazinylocta-3,5-dien-2-yl)hydrazine has a molecular weight of 334.55 g/mol, XLogP of 3.70, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,7-dicyclohexyl-7-hydrazinylocta-3,5-dien-2-yl)hydrazine is sourced from PubChem (CID 161041140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).