C27H39NO5 — CID 161041712
(1R,2S)-2-amino-1-phenylpropan-1-ol;(4R)-4-hydroxy-3,5,5-trimethylcyclohex-2-en-1-one;2,6,6-trimethylcyclohex-2-ene-1,4-dione (PubChem CID 161041712) has the molecular formula C27H39NO5 and a molecular weight of 457.61 g/mol. Its IUPAC name is (1R,2S)-2-amino-1-phenylpropan-1-ol;(4R)-4-hydroxy-3,5,5-trimethylcyclohex-2-en-1-one;2,6,6-trimethylcyclohex-2-ene-1,4-dione.
| Compound Name | (1R,2S)-2-amino-1-phenylpropan-1-ol;(4R)-4-hydroxy-3,5,5-trimethylcyclohex-2-en-1-one;2,6,6-trimethylcyclohex-2-ene-1,4-dione |
|---|---|
| PubChem CID | 161041712 |
| Molecular Formula | C27H39NO5 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | (1R,2S)-2-amino-1-phenylpropan-1-ol;(4R)-4-hydroxy-3,5,5-trimethylcyclohex-2-en-1-one;2,6,6-trimethylcyclohex-2-ene-1,4-dione |
| SMILES | CC1=CC(=O)CC(C)(C)C1=O.CC1=CC(=O)CC(C)(C)[C@H]1O.C[C@H](N)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C9H13NO.C9H14O2.C9H12O2/c1-7(10)9(11)8-5-3-2-4-6-8;2*1-6-4-7(10)5-9(2,3)8(6)11/h2-7,9,11H,10H2,1H3;4,8,11H,5H2,1-3H3;4H,5H2,1-3H3/t7-,9-;8-;/m00./s1 |
| InChIKey | UAYUDVYNKVUCIN-QSOZJIPRSA-N |
| XLogP | 3.86 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |