About diphenyltin(2+) diphenoxide
diphenyltin(2+) diphenoxide (PubChem CID 161045061) has the molecular formula C24H20O2Sn
and a molecular weight of 459.13 g/mol. Its IUPAC name is diphenyltin(2+) diphenoxide.
Molecular Properties
| Compound Name | diphenyltin(2+) diphenoxide |
| PubChem CID | 161045061 |
| Molecular Formula | C24H20O2Sn |
| Molecular Weight | 459.13 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | diphenyltin(2+) diphenoxide |
| SMILES | [O-]c1ccccc1.[O-]c1ccccc1.c1ccc([Sn+2]c2ccccc2)cc1 |
| InChI | InChI=1S/2C6H6O.2C6H5.Sn/c2*7-6-4-2-1-3-5-6;2*1-2-4-6-5-3-1;/h2*1-5,7H;2*1-5H;/q;;;;+2/p-2 |
| InChIKey | UBJYISAHIWZOQW-UHFFFAOYSA-L |
| XLogP | 2.86 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.13 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze diphenyltin(2+) diphenoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyltin(2+) diphenoxide?
The IUPAC name of diphenyltin(2+) diphenoxide (CID 161045061) is diphenyltin(2+) diphenoxide.
What is the SMILES notation for diphenyltin(2+) diphenoxide?
The canonical SMILES for diphenyltin(2+) diphenoxide is [O-]c1ccccc1.[O-]c1ccccc1.c1ccc([Sn+2]c2ccccc2)cc1.
What is the InChIKey of diphenyltin(2+) diphenoxide?
The InChIKey is UBJYISAHIWZOQW-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H6O.2C6H5.Sn/c2*7-6-4-2-1-3-5-6;2*1-2-4-6-5-3-1;/h2*1-5,7H;2*1-5H;/q;;;;+2/p-2.
What are the key properties of diphenyltin(2+) diphenoxide?
diphenyltin(2+) diphenoxide has a molecular weight of 459.13 g/mol, XLogP of 2.86, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyltin(2+) diphenoxide is sourced from PubChem (CID 161045061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).