C20H32O5SSi — CID 16104626
(3aR,4R,5R,6aS)-4-(benzenesulfonylmethyl)-5-triethylsilyloxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol (PubChem CID 16104626) has the molecular formula C20H32O5SSi and a molecular weight of 412.60 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-(benzenesulfonylmethyl)-5-triethylsilyloxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol.
| Compound Name | (3aR,4R,5R,6aS)-4-(benzenesulfonylmethyl)-5-triethylsilyloxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
|---|---|
| PubChem CID | 16104626 |
| Molecular Formula | C20H32O5SSi |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-(benzenesulfonylmethyl)-5-triethylsilyloxy-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2-ol |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C[C@H]2[C@@H]([C@H]1CS(=O)(=O)C3=CC=CC=C3)CC(O2)O |
| InChI | InChI=1S/C20H32O5SSi/c1-4-27(5-2,6-3)25-19-13-18-16(12-20(21)24-18)17(19)14-26(22,23)15-10-8-7-9-11-15/h7-11,16-21H,4-6,12-14H2,1-3H3/t16-,17-,18+,19-,20?/m1/s1 |
| InChIKey | BGKBAEAITKPVAG-QUIYGKKVSA-N |
| XLogP | — |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | 571 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|