C28H54O8 — CID 161050164
[5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-yl] acetate;(7,7-dimethoxy-5-propan-2-ylheptan-2-yl) acetate (PubChem CID 161050164) has the molecular formula C28H54O8 and a molecular weight of 518.73 g/mol. Its IUPAC name is [5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-yl] acetate;(7,7-dimethoxy-5-propan-2-ylheptan-2-yl) acetate.
| Compound Name | [5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-yl] acetate;(7,7-dimethoxy-5-propan-2-ylheptan-2-yl) acetate |
|---|---|
| PubChem CID | 161050164 |
| Molecular Formula | C28H54O8 |
| Molecular Weight | 518.73 g/mol |
| Exact Mass | 518.38 |
| IUPAC Name | [5-(2,2-dimethoxyethyl)-6-methylhept-6-en-2-yl] acetate;(7,7-dimethoxy-5-propan-2-ylheptan-2-yl) acetate |
| SMILES | C=C(C)C(CCC(C)OC(C)=O)CC(OC)OC.COC(CC(CCC(C)OC(C)=O)C(C)C)OC |
| InChI | InChI=1S/C14H28O4.C14H26O4/c2*1-10(2)13(9-14(16-5)17-6)8-7-11(3)18-12(4)15/h10-11,13-14H,7-9H2,1-6H3;11,13-14H,1,7-9H2,2-6H3 |
| InChIKey | UCALOPHENXEQCC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.73 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|