About 3-acetamidooxycarbonyl-5-amino-2,4,6-triiodobenzoic acid
3-acetamidooxycarbonyl-5-amino-2,4,6-triiodobenzoic acid (PubChem CID 161050500) has the molecular formula C10H7I3N2O5
and a molecular weight of 615.89 g/mol. Its IUPAC name is 3-acetamidooxycarbonyl-5-amino-2,4,6-triiodobenzoic acid.
Molecular Properties
| Compound Name | 3-acetamidooxycarbonyl-5-amino-2,4,6-triiodobenzoic acid |
| PubChem CID | 161050500 |
| Molecular Formula | C10H7I3N2O5 |
| Molecular Weight | 615.89 g/mol |
| Exact Mass | 615.75 |
| IUPAC Name | 3-acetamidooxycarbonyl-5-amino-2,4,6-triiodobenzoic acid |
| SMILES | CC(=O)NOC(=O)c1c(I)c(N)c(I)c(C(=O)O)c1I |
| InChI | InChI=1S/C10H7I3N2O5/c1-2(16)15-20-10(19)4-5(11)3(9(17)18)6(12)8(14)7(4)13/h14H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | UCBPBIDRSKKNCD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 615.89 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-acetamidooxycarbonyl-5-amino-2,4,6-triiodobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetamidooxycarbonyl-5-amino-2,4,6-triiodobenzoic acid?
The IUPAC name of 3-acetamidooxycarbonyl-5-amino-2,4,6-triiodobenzoic acid (CID 161050500) is 3-acetamidooxycarbonyl-5-amino-2,4,6-triiodobenzoic acid.
What is the SMILES notation for 3-acetamidooxycarbonyl-5-amino-2,4,6-triiodobenzoic acid?
The canonical SMILES for 3-acetamidooxycarbonyl-5-amino-2,4,6-triiodobenzoic acid is CC(=O)NOC(=O)c1c(I)c(N)c(I)c(C(=O)O)c1I.
What is the InChIKey of 3-acetamidooxycarbonyl-5-amino-2,4,6-triiodobenzoic acid?
The InChIKey is UCBPBIDRSKKNCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7I3N2O5/c1-2(16)15-20-10(19)4-5(11)3(9(17)18)6(12)8(14)7(4)13/h14H2,1H3,(H,15,16)(H,17,18).
What are the key properties of 3-acetamidooxycarbonyl-5-amino-2,4,6-triiodobenzoic acid?
3-acetamidooxycarbonyl-5-amino-2,4,6-triiodobenzoic acid has a molecular weight of 615.89 g/mol, XLogP of 1.99, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetamidooxycarbonyl-5-amino-2,4,6-triiodobenzoic acid is sourced from PubChem (CID 161050500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).