C95H86F3IrN4 — CID 161052251
CID 161052251 (PubChem CID 161052251) has the molecular formula C95H86F3IrN4 and a molecular weight of 1532.97 g/mol.
| Compound Name | CID 161052251 |
|---|---|
| PubChem CID | 161052251 |
| Molecular Formula | C95H86F3IrN4 |
| Molecular Weight | 1532.97 g/mol |
| Exact Mass | 1532.64 |
| IUPAC Name | — |
| SMILES | Cc1cccc(-c2cc(-c3cc(C(C)(C)C)ccn3)[c-]cc2-c2cc(C(C)(C)C)ccc2C2CC(c3ccccc3-c3c[c-]c4c(c3)c3ccccc3n3c5ccccc5nc43)CC(c3ccc(C(C)(C)C)cc3-c3c[c-]c(-c4cc(C(C)(C)C)ccn4)cc3-c3cccc(C(F)(F)F)c3)C2)c1.[Ir+3] |
| InChI | InChI=1S/C95H86F3N4.Ir/c1-58-22-20-23-59(46-58)80-52-62(86-56-69(42-44-99-86)93(8,9)10)33-37-76(80)83-54-67(91(2,3)4)35-40-74(83)65-47-64(73-27-15-14-26-72(73)61-32-39-79-82(51-61)78-28-16-18-30-88(78)102-89-31-19-17-29-85(89)101-90(79)102)48-66(49-65)75-41-36-68(92(5,6)7)55-84(75)77-38-34-63(87-57-70(43-45-100-87)94(11,12)13)53-81(77)60-24-21-25-71(50-60)95(96,97)98;/h14-32,35-38,40-46,50-57,64-66H,47-49H2,1-13H3;/q-3;+3 |
| InChIKey | IAEWQSGXFNWGLP-UHFFFAOYSA-N |
| XLogP | 26.00 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 103 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1532.97 |
| LogP ≤ 5 | 26.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|