C23H17F2N3O — CID 161052863
3-[[4-(3a,7a-dihydro-3H-inden-5-yl)-2,6-difluorophenyl]methyl]pyrido[3,4-d]pyrimidin-4-one (PubChem CID 161052863) has the molecular formula C23H17F2N3O and a molecular weight of 389.41 g/mol. Its IUPAC name is 3-[[4-(3a,7a-dihydro-3H-inden-5-yl)-2,6-difluorophenyl]methyl]pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 3-[[4-(3a,7a-dihydro-3H-inden-5-yl)-2,6-difluorophenyl]methyl]pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 161052863 |
| Molecular Formula | C23H17F2N3O |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 3-[[4-(3a,7a-dihydro-3H-inden-5-yl)-2,6-difluorophenyl]methyl]pyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1c2ccncc2ncn1Cc1c(F)cc(C2=CC3CC=CC3C=C2)cc1F |
| InChI | InChI=1S/C23H17F2N3O/c24-20-9-17(16-5-4-14-2-1-3-15(14)8-16)10-21(25)19(20)12-28-13-27-22-11-26-7-6-18(22)23(28)29/h1-2,4-11,13-15H,3,12H2 |
| InChIKey | PKTZQILSJZVZCL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|