C19H19Cl3FN3O2S2 — CID 161056346
2,4-dichloro-N-(3-chloro-4-fluoro-5-methylphenyl)-5-(4-methylpiperazin-1-yl)sulfonylbenzenecarbothioamide (PubChem CID 161056346) has the molecular formula C19H19Cl3FN3O2S2 and a molecular weight of 510.87 g/mol. Its IUPAC name is 2,4-dichloro-N-(3-chloro-4-fluoro-5-methylphenyl)-5-(4-methylpiperazin-1-yl)sulfonylbenzenecarbothioamide.
| Compound Name | 2,4-dichloro-N-(3-chloro-4-fluoro-5-methylphenyl)-5-(4-methylpiperazin-1-yl)sulfonylbenzenecarbothioamide |
|---|---|
| PubChem CID | 161056346 |
| Molecular Formula | C19H19Cl3FN3O2S2 |
| Molecular Weight | 510.87 g/mol |
| Exact Mass | 509.00 |
| IUPAC Name | 2,4-dichloro-N-(3-chloro-4-fluoro-5-methylphenyl)-5-(4-methylpiperazin-1-yl)sulfonylbenzenecarbothioamide |
| SMILES | Cc1cc(NC(=S)c2cc(S(=O)(=O)N3CCN(C)CC3)c(Cl)cc2Cl)cc(Cl)c1F |
| InChI | InChI=1S/C19H19Cl3FN3O2S2/c1-11-7-12(8-16(22)18(11)23)24-19(29)13-9-17(15(21)10-14(13)20)30(27,28)26-5-3-25(2)4-6-26/h7-10H,3-6H2,1-2H3,(H,24,29) |
| InChIKey | DTIRRBSQNYXUTE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.87 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|