About 5-[(6-chloro-5-isoquinolin-2-ium-4-yl-1H-benzimidazol-2-yl)oxy]-2-methylbenzoic acid;formic acid
5-[(6-chloro-5-isoquinolin-2-ium-4-yl-1H-benzimidazol-2-yl)oxy]-2-methylbenzoic acid;formic acid (PubChem CID 161056568) has the molecular formula C25H19ClN3O5+
and a molecular weight of 476.90 g/mol. Its IUPAC name is 5-[(6-chloro-5-isoquinolin-2-ium-4-yl-1H-benzimidazol-2-yl)oxy]-2-methylbenzoic acid;formic acid.
Molecular Properties
| Compound Name | 5-[(6-chloro-5-isoquinolin-2-ium-4-yl-1H-benzimidazol-2-yl)oxy]-2-methylbenzoic acid;formic acid |
| PubChem CID | 161056568 |
| Molecular Formula | C25H19ClN3O5+ |
| Molecular Weight | 476.90 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 5-[(6-chloro-5-isoquinolin-2-ium-4-yl-1H-benzimidazol-2-yl)oxy]-2-methylbenzoic acid;formic acid |
| SMILES | Cc1ccc(Oc2nc3cc(-c4c[nH+]cc5ccccc45)c(Cl)cc3[nH]2)cc1C(=O)O.O=CO |
| InChI | InChI=1S/C24H16ClN3O3.CH2O2/c1-13-6-7-15(8-17(13)23(29)30)31-24-27-21-9-18(20(25)10-22(21)28-24)19-12-26-11-14-4-2-3-5-16(14)19;2-1-3/h2-12H,1H3,(H,27,28)(H,29,30);1H,(H,2,3)/p+1 |
| InChIKey | UCVIPFOZLYIZGU-UHFFFAOYSA-O |
| XLogP | 5.35 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.90 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-[(6-chloro-5-isoquinolin-2-ium-4-yl-1H-benzimidazol-2-yl)oxy]-2-methylbenzoic acid;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(6-chloro-5-isoquinolin-2-ium-4-yl-1H-benzimidazol-2-yl)oxy]-2-methylbenzoic acid;formic acid?
The IUPAC name of 5-[(6-chloro-5-isoquinolin-2-ium-4-yl-1H-benzimidazol-2-yl)oxy]-2-methylbenzoic acid;formic acid (CID 161056568) is 5-[(6-chloro-5-isoquinolin-2-ium-4-yl-1H-benzimidazol-2-yl)oxy]-2-methylbenzoic acid;formic acid.
What is the SMILES notation for 5-[(6-chloro-5-isoquinolin-2-ium-4-yl-1H-benzimidazol-2-yl)oxy]-2-methylbenzoic acid;formic acid?
The canonical SMILES for 5-[(6-chloro-5-isoquinolin-2-ium-4-yl-1H-benzimidazol-2-yl)oxy]-2-methylbenzoic acid;formic acid is Cc1ccc(Oc2nc3cc(-c4c[nH+]cc5ccccc45)c(Cl)cc3[nH]2)cc1C(=O)O.O=CO.
What is the InChIKey of 5-[(6-chloro-5-isoquinolin-2-ium-4-yl-1H-benzimidazol-2-yl)oxy]-2-methylbenzoic acid;formic acid?
The InChIKey is UCVIPFOZLYIZGU-UHFFFAOYSA-O. The full InChI is InChI=1S/C24H16ClN3O3.CH2O2/c1-13-6-7-15(8-17(13)23(29)30)31-24-27-21-9-18(20(25)10-22(21)28-24)19-12-26-11-14-4-2-3-5-16(14)19;2-1-3/h2-12H,1H3,(H,27,28)(H,29,30);1H,(H,2,3)/p+1.
What are the key properties of 5-[(6-chloro-5-isoquinolin-2-ium-4-yl-1H-benzimidazol-2-yl)oxy]-2-methylbenzoic acid;formic acid?
5-[(6-chloro-5-isoquinolin-2-ium-4-yl-1H-benzimidazol-2-yl)oxy]-2-methylbenzoic acid;formic acid has a molecular weight of 476.90 g/mol, XLogP of 5.35, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(6-chloro-5-isoquinolin-2-ium-4-yl-1H-benzimidazol-2-yl)oxy]-2-methylbenzoic acid;formic acid is sourced from PubChem (CID 161056568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).