C32H29ClN4O6 — CID 161058988
ethyl 2-chloroacetate;ethyl 2-[(3-cyano-4-phenyl-2-pyridinyl)oxy]acetate;2-oxo-4-phenyl-1H-pyridine-3-carbonitrile (PubChem CID 161058988) has the molecular formula C32H29ClN4O6 and a molecular weight of 601.06 g/mol. Its IUPAC name is ethyl 2-chloroacetate;ethyl 2-[(3-cyano-4-phenyl-2-pyridinyl)oxy]acetate;2-oxo-4-phenyl-1H-pyridine-3-carbonitrile.
| Compound Name | ethyl 2-chloroacetate;ethyl 2-[(3-cyano-4-phenyl-2-pyridinyl)oxy]acetate;2-oxo-4-phenyl-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 161058988 |
| Molecular Formula | C32H29ClN4O6 |
| Molecular Weight | 601.06 g/mol |
| Exact Mass | 600.18 |
| IUPAC Name | ethyl 2-chloroacetate;ethyl 2-[(3-cyano-4-phenyl-2-pyridinyl)oxy]acetate;2-oxo-4-phenyl-1H-pyridine-3-carbonitrile |
| SMILES | CCOC(=O)CCl.CCOC(=O)COc1nccc(-c2ccccc2)c1C#N.N#Cc1c(-c2ccccc2)cc[nH]c1=O |
| InChI | InChI=1S/C16H14N2O3.C12H8N2O.C4H7ClO2/c1-2-20-15(19)11-21-16-14(10-17)13(8-9-18-16)12-6-4-3-5-7-12;13-8-11-10(6-7-14-12(11)15)9-4-2-1-3-5-9;1-2-7-4(6)3-5/h3-9H,2,11H2,1H3;1-7H,(H,14,15);2-3H2,1H3 |
| InChIKey | UDDIGWVJQJQZJO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 155.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.06 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|