C19H23N3O2 — CID 161060422
[1-(4-methylphenyl)piperidin-4-yl] N-(5-methyl-2-pyridinyl)carbamate (PubChem CID 161060422) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is [1-(4-methylphenyl)piperidin-4-yl] N-(5-methyl-2-pyridinyl)carbamate.
| Compound Name | [1-(4-methylphenyl)piperidin-4-yl] N-(5-methyl-2-pyridinyl)carbamate |
|---|---|
| PubChem CID | 161060422 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | [1-(4-methylphenyl)piperidin-4-yl] N-(5-methyl-2-pyridinyl)carbamate |
| SMILES | Cc1ccc(N2CCC(OC(=O)Nc3ccc(C)cn3)CC2)cc1 |
| InChI | InChI=1S/C19H23N3O2/c1-14-3-6-16(7-4-14)22-11-9-17(10-12-22)24-19(23)21-18-8-5-15(2)13-20-18/h3-8,13,17H,9-12H2,1-2H3,(H,20,21,23) |
| InChIKey | VSUPJUAILLXZOK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|