C12H9F3N2O4 — CID 161062008
9H-1,4-benzodiazepine-8-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 161062008) has the molecular formula C12H9F3N2O4 and a molecular weight of 302.21 g/mol. Its IUPAC name is 9H-1,4-benzodiazepine-8-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 9H-1,4-benzodiazepine-8-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 161062008 |
| Molecular Formula | C12H9F3N2O4 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 9H-1,4-benzodiazepine-8-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C1=CC=C2C=NC=CN=C2C1 |
| InChI | InChI=1S/C10H8N2O2.C2HF3O2/c13-10(14)7-1-2-8-6-11-3-4-12-9(8)5-7;3-2(4,5)1(6)7/h1-4,6H,5H2,(H,13,14);(H,6,7) |
| InChIKey | UDNFHBNSNLYCGF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 99.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |