C18H22N2O3 — CID 161062833
2,6-dimethylbenzohydrazide;2,6-dimethylbenzoic acid (PubChem CID 161062833) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2,6-dimethylbenzohydrazide;2,6-dimethylbenzoic acid.
| Compound Name | 2,6-dimethylbenzohydrazide;2,6-dimethylbenzoic acid |
|---|---|
| PubChem CID | 161062833 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2,6-dimethylbenzohydrazide;2,6-dimethylbenzoic acid |
| SMILES | Cc1cccc(C)c1C(=O)NN.Cc1cccc(C)c1C(=O)O |
| InChI | InChI=1S/C9H12N2O.C9H10O2/c1-6-4-3-5-7(2)8(6)9(12)11-10;1-6-4-3-5-7(2)8(6)9(10)11/h3-5H,10H2,1-2H3,(H,11,12);3-5H,1-2H3,(H,10,11) |
| InChIKey | UDPSWZQGOQGWCU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|