About 4-benzylsulfanyl-2-chlorophenol;4-bromo-2-chlorophenol
4-benzylsulfanyl-2-chlorophenol;4-bromo-2-chlorophenol (PubChem CID 161063142) has the molecular formula C19H15BrCl2O2S
and a molecular weight of 458.20 g/mol. Its IUPAC name is 4-benzylsulfanyl-2-chlorophenol;4-bromo-2-chlorophenol.
Molecular Properties
| Compound Name | 4-benzylsulfanyl-2-chlorophenol;4-bromo-2-chlorophenol |
| PubChem CID | 161063142 |
| Molecular Formula | C19H15BrCl2O2S |
| Molecular Weight | 458.20 g/mol |
| Exact Mass | 455.94 |
| IUPAC Name | 4-benzylsulfanyl-2-chlorophenol;4-bromo-2-chlorophenol |
| SMILES | Oc1ccc(Br)cc1Cl.Oc1ccc(SCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C13H11ClOS.C6H4BrClO/c14-12-8-11(6-7-13(12)15)16-9-10-4-2-1-3-5-10;7-4-1-2-6(9)5(8)3-4/h1-8,15H,9H2;1-3,9H |
| InChIKey | UDQUXTLDUNJSSD-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.20 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-benzylsulfanyl-2-chlorophenol;4-bromo-2-chlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzylsulfanyl-2-chlorophenol;4-bromo-2-chlorophenol?
The IUPAC name of 4-benzylsulfanyl-2-chlorophenol;4-bromo-2-chlorophenol (CID 161063142) is 4-benzylsulfanyl-2-chlorophenol;4-bromo-2-chlorophenol.
What is the SMILES notation for 4-benzylsulfanyl-2-chlorophenol;4-bromo-2-chlorophenol?
The canonical SMILES for 4-benzylsulfanyl-2-chlorophenol;4-bromo-2-chlorophenol is Oc1ccc(Br)cc1Cl.Oc1ccc(SCc2ccccc2)cc1Cl.
What is the InChIKey of 4-benzylsulfanyl-2-chlorophenol;4-bromo-2-chlorophenol?
The InChIKey is UDQUXTLDUNJSSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClOS.C6H4BrClO/c14-12-8-11(6-7-13(12)15)16-9-10-4-2-1-3-5-10;7-4-1-2-6(9)5(8)3-4/h1-8,15H,9H2;1-3,9H.
What are the key properties of 4-benzylsulfanyl-2-chlorophenol;4-bromo-2-chlorophenol?
4-benzylsulfanyl-2-chlorophenol;4-bromo-2-chlorophenol has a molecular weight of 458.20 g/mol, XLogP of 7.15, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzylsulfanyl-2-chlorophenol;4-bromo-2-chlorophenol is sourced from PubChem (CID 161063142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).