C30H38F2N2O4 — CID 161063465
2-[2-(5,5-difluorooxan-2-yl)phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 161063465) has the molecular formula C30H38F2N2O4 and a molecular weight of 528.64 g/mol. Its IUPAC name is 2-[2-(5,5-difluorooxan-2-yl)phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[2-(5,5-difluorooxan-2-yl)phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 161063465 |
| Molecular Formula | C30H38F2N2O4 |
| Molecular Weight | 528.64 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | 2-[2-(5,5-difluorooxan-2-yl)phenyl]-2-[(3R)-3-[4-(5,6,7,8-tetrahydroquinolin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)C(c1ccccc1C1CCC(F)(F)CO1)N1CC[C@@H](OCCCCc2ccc3c(n2)CCCC3)C1 |
| InChI | InChI=1S/C30H38F2N2O4/c31-30(32)16-14-27(38-20-30)24-9-2-3-10-25(24)28(29(35)36)34-17-15-23(19-34)37-18-6-5-8-22-13-12-21-7-1-4-11-26(21)33-22/h2-3,9-10,12-13,23,27-28H,1,4-8,11,14-20H2,(H,35,36)/t23-,27?,28?/m1/s1 |
| InChIKey | UDRWSNAJCYMBCO-YHHYGRTJSA-N |
| XLogP | 5.69 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.64 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|