About 2-tert-butylperoxy-2-methylpropane;octane
2-tert-butylperoxy-2-methylpropane;octane (PubChem CID 161064839) has the molecular formula C16H36O2
and a molecular weight of 260.46 g/mol. Its IUPAC name is 2-tert-butylperoxy-2-methylpropane;octane.
Molecular Properties
| Compound Name | 2-tert-butylperoxy-2-methylpropane;octane |
| PubChem CID | 161064839 |
| Molecular Formula | C16H36O2 |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.27 |
| IUPAC Name | 2-tert-butylperoxy-2-methylpropane;octane |
| SMILES | CC(C)(C)OOC(C)(C)C.CCCCCCCC |
| InChI | InChI=1S/C8H18O2.C8H18/c1-7(2,3)9-10-8(4,5)6;1-3-5-7-8-6-4-2/h1-6H3;3-8H2,1-2H3 |
| InChIKey | UDWNNNSAPMHWBY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-tert-butylperoxy-2-methylpropane;octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butylperoxy-2-methylpropane;octane?
The IUPAC name of 2-tert-butylperoxy-2-methylpropane;octane (CID 161064839) is 2-tert-butylperoxy-2-methylpropane;octane.
What is the SMILES notation for 2-tert-butylperoxy-2-methylpropane;octane?
The canonical SMILES for 2-tert-butylperoxy-2-methylpropane;octane is CC(C)(C)OOC(C)(C)C.CCCCCCCC.
What is the InChIKey of 2-tert-butylperoxy-2-methylpropane;octane?
The InChIKey is UDWNNNSAPMHWBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O2.C8H18/c1-7(2,3)9-10-8(4,5)6;1-3-5-7-8-6-4-2/h1-6H3;3-8H2,1-2H3.
What are the key properties of 2-tert-butylperoxy-2-methylpropane;octane?
2-tert-butylperoxy-2-methylpropane;octane has a molecular weight of 260.46 g/mol, XLogP of 5.90, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butylperoxy-2-methylpropane;octane is sourced from PubChem (CID 161064839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).