C21H16F3N3O4S2 — CID 161065780
4-[4-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2-pyridinyl]-1,1,1-trifluoro-4-iminobut-2-en-2-amine (PubChem CID 161065780) has the molecular formula C21H16F3N3O4S2 and a molecular weight of 495.50 g/mol. Its IUPAC name is 4-[4-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2-pyridinyl]-1,1,1-trifluoro-4-iminobut-2-en-2-amine.
| Compound Name | 4-[4-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2-pyridinyl]-1,1,1-trifluoro-4-iminobut-2-en-2-amine |
|---|---|
| PubChem CID | 161065780 |
| Molecular Formula | C21H16F3N3O4S2 |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 495.05 |
| IUPAC Name | 4-[4-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]-2-pyridinyl]-1,1,1-trifluoro-4-iminobut-2-en-2-amine |
| SMILES | [H]/N=C(\C=C(N)C(F)(F)F)c1cc(-c2sc(-c3scc4c3OCCO4)c3c2OCCO3)ccn1 |
| InChI | InChI=1S/C21H16F3N3O4S2/c22-21(23,24)14(26)8-11(25)12-7-10(1-2-27-12)18-16-17(31-6-5-30-16)20(33-18)19-15-13(9-32-19)28-3-4-29-15/h1-2,7-9,25H,3-6,26H2/b14-8?,25-11+ |
| InChIKey | APHUOSCHLPEPSC-WOTOHXKGSA-N |
| XLogP | 4.85 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|