About methane;2-[4-[[4-(2H-tetrazol-5-yl)anilino]methyl]phenoxy]acetic acid
methane;2-[4-[[4-(2H-tetrazol-5-yl)anilino]methyl]phenoxy]acetic acid (PubChem CID 161066134) has the molecular formula C17H19N5O3
and a molecular weight of 341.37 g/mol. Its IUPAC name is methane;2-[4-[[4-(2H-tetrazol-5-yl)anilino]methyl]phenoxy]acetic acid.
Molecular Properties
| Compound Name | methane;2-[4-[[4-(2H-tetrazol-5-yl)anilino]methyl]phenoxy]acetic acid |
| PubChem CID | 161066134 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | methane;2-[4-[[4-(2H-tetrazol-5-yl)anilino]methyl]phenoxy]acetic acid |
| SMILES | C.O=C(O)COc1ccc(CNc2ccc(-c3nn[nH]n3)cc2)cc1 |
| InChI | InChI=1S/C16H15N5O3.CH4/c22-15(23)10-24-14-7-1-11(2-8-14)9-17-13-5-3-12(4-6-13)16-18-20-21-19-16;/h1-8,17H,9-10H2,(H,22,23)(H,18,19,20,21);1H4 |
| InChIKey | UEAWKGDSWFSPAW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methane;2-[4-[[4-(2H-tetrazol-5-yl)anilino]methyl]phenoxy]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-[4-[[4-(2H-tetrazol-5-yl)anilino]methyl]phenoxy]acetic acid?
The IUPAC name of methane;2-[4-[[4-(2H-tetrazol-5-yl)anilino]methyl]phenoxy]acetic acid (CID 161066134) is methane;2-[4-[[4-(2H-tetrazol-5-yl)anilino]methyl]phenoxy]acetic acid.
What is the SMILES notation for methane;2-[4-[[4-(2H-tetrazol-5-yl)anilino]methyl]phenoxy]acetic acid?
The canonical SMILES for methane;2-[4-[[4-(2H-tetrazol-5-yl)anilino]methyl]phenoxy]acetic acid is C.O=C(O)COc1ccc(CNc2ccc(-c3nn[nH]n3)cc2)cc1.
What is the InChIKey of methane;2-[4-[[4-(2H-tetrazol-5-yl)anilino]methyl]phenoxy]acetic acid?
The InChIKey is UEAWKGDSWFSPAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5O3.CH4/c22-15(23)10-24-14-7-1-11(2-8-14)9-17-13-5-3-12(4-6-13)16-18-20-21-19-16;/h1-8,17H,9-10H2,(H,22,23)(H,18,19,20,21);1H4.
What are the key properties of methane;2-[4-[[4-(2H-tetrazol-5-yl)anilino]methyl]phenoxy]acetic acid?
methane;2-[4-[[4-(2H-tetrazol-5-yl)anilino]methyl]phenoxy]acetic acid has a molecular weight of 341.37 g/mol, XLogP of 2.58, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-[4-[[4-(2H-tetrazol-5-yl)anilino]methyl]phenoxy]acetic acid is sourced from PubChem (CID 161066134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).