About 1,1'-biphenyl;1,3,5-triazin-2-ylboronic acid
1,1'-biphenyl;1,3,5-triazin-2-ylboronic acid (PubChem CID 161066670) has the molecular formula C15H14BN3O2
and a molecular weight of 279.11 g/mol. Its IUPAC name is 1,1'-biphenyl;1,3,5-triazin-2-ylboronic acid.
Molecular Properties
| Compound Name | 1,1'-biphenyl;1,3,5-triazin-2-ylboronic acid |
| PubChem CID | 161066670 |
| Molecular Formula | C15H14BN3O2 |
| Molecular Weight | 279.11 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 1,1'-biphenyl;1,3,5-triazin-2-ylboronic acid |
| SMILES | OB(O)c1ncncn1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C3H4BN3O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;8-4(9)3-6-1-5-2-7-3/h1-10H;1-2,8-9H |
| InChIKey | UECNDPYGOVMNJY-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.11 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;1,3,5-triazin-2-ylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;1,3,5-triazin-2-ylboronic acid?
The IUPAC name of 1,1'-biphenyl;1,3,5-triazin-2-ylboronic acid (CID 161066670) is 1,1'-biphenyl;1,3,5-triazin-2-ylboronic acid.
What is the SMILES notation for 1,1'-biphenyl;1,3,5-triazin-2-ylboronic acid?
The canonical SMILES for 1,1'-biphenyl;1,3,5-triazin-2-ylboronic acid is OB(O)c1ncncn1.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;1,3,5-triazin-2-ylboronic acid?
The InChIKey is UECNDPYGOVMNJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C3H4BN3O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;8-4(9)3-6-1-5-2-7-3/h1-10H;1-2,8-9H.
What are the key properties of 1,1'-biphenyl;1,3,5-triazin-2-ylboronic acid?
1,1'-biphenyl;1,3,5-triazin-2-ylboronic acid has a molecular weight of 279.11 g/mol, XLogP of 0.90, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;1,3,5-triazin-2-ylboronic acid is sourced from PubChem (CID 161066670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).