C24H23Cl2N3O5S — CID 161068818
1-(7-chloro-1-benzofuran-2-yl)-1-(5-chloro-2-methoxyphenyl)-2-methylguanidine;4-methylbenzenesulfonic acid (PubChem CID 161068818) has the molecular formula C24H23Cl2N3O5S and a molecular weight of 536.44 g/mol. Its IUPAC name is 1-(7-chloro-1-benzofuran-2-yl)-1-(5-chloro-2-methoxyphenyl)-2-methylguanidine;4-methylbenzenesulfonic acid.
| Compound Name | 1-(7-chloro-1-benzofuran-2-yl)-1-(5-chloro-2-methoxyphenyl)-2-methylguanidine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 161068818 |
| Molecular Formula | C24H23Cl2N3O5S |
| Molecular Weight | 536.44 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | 1-(7-chloro-1-benzofuran-2-yl)-1-(5-chloro-2-methoxyphenyl)-2-methylguanidine;4-methylbenzenesulfonic acid |
| SMILES | C/N=C(\N)N(c1cc2cccc(Cl)c2o1)c1cc(Cl)ccc1OC.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C17H15Cl2N3O2.C7H8O3S/c1-21-17(20)22(13-9-11(18)6-7-14(13)23-2)15-8-10-4-3-5-12(19)16(10)24-15;1-6-2-4-7(5-3-6)11(8,9)10/h3-9H,1-2H3,(H2,20,21);2-5H,1H3,(H,8,9,10) |
| InChIKey | CGRCJPXBTJTHBM-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.44 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|