C20H31N3O4 — CID 161068958
2-cyanoethyl N-[[5-[3-(2-isocyanoethoxy)-2-oxopropyl]-1,3,3-trimethylcyclohexyl]methyl]carbamate (PubChem CID 161068958) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-cyanoethyl N-[[5-[3-(2-isocyanoethoxy)-2-oxopropyl]-1,3,3-trimethylcyclohexyl]methyl]carbamate.
| Compound Name | 2-cyanoethyl N-[[5-[3-(2-isocyanoethoxy)-2-oxopropyl]-1,3,3-trimethylcyclohexyl]methyl]carbamate |
|---|---|
| PubChem CID | 161068958 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | 2-cyanoethyl N-[[5-[3-(2-isocyanoethoxy)-2-oxopropyl]-1,3,3-trimethylcyclohexyl]methyl]carbamate |
| SMILES | [C-]#[N+]CCOCC(=O)CC1CC(C)(C)CC(C)(CNC(=O)OCCC#N)C1 |
| InChI | InChI=1S/C20H31N3O4/c1-19(2)11-16(10-17(24)13-26-9-7-22-4)12-20(3,14-19)15-23-18(25)27-8-5-6-21/h16H,5,7-15H2,1-3H3,(H,23,25) |
| InChIKey | LBCDOYJTXVMZJY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|