C27H33ClN10O2 — CID 161068997
7-(1-benzylpiperidin-4-yl)-9H-purin-8-one;7-piperidin-4-yl-9H-purin-8-one;hydrochloride (PubChem CID 161068997) has the molecular formula C27H33ClN10O2 and a molecular weight of 565.08 g/mol. Its IUPAC name is 7-(1-benzylpiperidin-4-yl)-9H-purin-8-one;7-piperidin-4-yl-9H-purin-8-one;hydrochloride.
| Compound Name | 7-(1-benzylpiperidin-4-yl)-9H-purin-8-one;7-piperidin-4-yl-9H-purin-8-one;hydrochloride |
|---|---|
| PubChem CID | 161068997 |
| Molecular Formula | C27H33ClN10O2 |
| Molecular Weight | 565.08 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | 7-(1-benzylpiperidin-4-yl)-9H-purin-8-one;7-piperidin-4-yl-9H-purin-8-one;hydrochloride |
| SMILES | Cl.O=c1[nH]c2ncncc2n1C1CCN(Cc2ccccc2)CC1.O=c1[nH]c2ncncc2n1C1CCNCC1 |
| InChI | InChI=1S/C17H19N5O.C10H13N5O.ClH/c23-17-20-16-15(10-18-12-19-16)22(17)14-6-8-21(9-7-14)11-13-4-2-1-3-5-13;16-10-14-9-8(5-12-6-13-9)15(10)7-1-3-11-4-2-7;/h1-5,10,12,14H,6-9,11H2,(H,18,19,20,23);5-7,11H,1-4H2,(H,12,13,14,16);1H |
| InChIKey | ZZILKAKVVTXZKM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 142.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.08 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |