C20H20N2O2S — CID 161069206
7-[[(Z)-3-(4-methylphenyl)-1-methylsulfanyl-3-oxoprop-1-enyl]amino]-2,4-dihydro-1H-isoquinolin-3-one (PubChem CID 161069206) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is 7-[[(Z)-3-(4-methylphenyl)-1-methylsulfanyl-3-oxoprop-1-enyl]amino]-2,4-dihydro-1H-isoquinolin-3-one.
| Compound Name | 7-[[(Z)-3-(4-methylphenyl)-1-methylsulfanyl-3-oxoprop-1-enyl]amino]-2,4-dihydro-1H-isoquinolin-3-one |
|---|---|
| PubChem CID | 161069206 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 7-[[(Z)-3-(4-methylphenyl)-1-methylsulfanyl-3-oxoprop-1-enyl]amino]-2,4-dihydro-1H-isoquinolin-3-one |
| SMILES | CS/C(=C\C(=O)c1ccc(C)cc1)Nc1ccc2c(c1)CNC(=O)C2 |
| InChI | InChI=1S/C20H20N2O2S/c1-13-3-5-14(6-4-13)18(23)11-20(25-2)22-17-8-7-15-10-19(24)21-12-16(15)9-17/h3-9,11,22H,10,12H2,1-2H3,(H,21,24)/b20-11- |
| InChIKey | KEVXDRMHQDTVQT-JAIQZWGSSA-N |
| XLogP | 3.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|