About 1-ethyl-2H-pyridine;tetrafluorophosphanium
1-ethyl-2H-pyridine;tetrafluorophosphanium (PubChem CID 161069901) has the molecular formula C7H11F4NP+
and a molecular weight of 216.14 g/mol. Its IUPAC name is 1-ethyl-2H-pyridine;tetrafluorophosphanium.
Molecular Properties
| Compound Name | 1-ethyl-2H-pyridine;tetrafluorophosphanium |
| PubChem CID | 161069901 |
| Molecular Formula | C7H11F4NP+ |
| Molecular Weight | 216.14 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 1-ethyl-2H-pyridine;tetrafluorophosphanium |
| SMILES | CCN1C=CC=CC1.F[P+](F)(F)F |
| InChI | InChI=1S/C7H11N.F4P/c1-2-8-6-4-3-5-7-8;1-5(2,3)4/h3-6H,2,7H2,1H3;/q;+1 |
| InChIKey | ZYYLGTHRABBGBV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.14 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2H-pyridine;tetrafluorophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2H-pyridine;tetrafluorophosphanium?
The IUPAC name of 1-ethyl-2H-pyridine;tetrafluorophosphanium (CID 161069901) is 1-ethyl-2H-pyridine;tetrafluorophosphanium.
What is the SMILES notation for 1-ethyl-2H-pyridine;tetrafluorophosphanium?
The canonical SMILES for 1-ethyl-2H-pyridine;tetrafluorophosphanium is CCN1C=CC=CC1.F[P+](F)(F)F.
What is the InChIKey of 1-ethyl-2H-pyridine;tetrafluorophosphanium?
The InChIKey is ZYYLGTHRABBGBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N.F4P/c1-2-8-6-4-3-5-7-8;1-5(2,3)4/h3-6H,2,7H2,1H3;/q;+1.
What are the key properties of 1-ethyl-2H-pyridine;tetrafluorophosphanium?
1-ethyl-2H-pyridine;tetrafluorophosphanium has a molecular weight of 216.14 g/mol, XLogP of 3.93, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2H-pyridine;tetrafluorophosphanium is sourced from PubChem (CID 161069901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).