C58H78ClN5O6 — CID 161070883
ethyl 4-(1-adamantylmethyl)-3-(pyrimidin-4-ylmethylamino)benzoate;ethyl 5-amino-2-chloro-4-(cyclohexylmethyl)benzoate;ethyl 5-amino-4-(cyclohexylmethyl)-2-methylbenzoate (PubChem CID 161070883) has the molecular formula C58H78ClN5O6 and a molecular weight of 976.74 g/mol. Its IUPAC name is ethyl 4-(1-adamantylmethyl)-3-(pyrimidin-4-ylmethylamino)benzoate;ethyl 5-amino-2-chloro-4-(cyclohexylmethyl)benzoate;ethyl 5-amino-4-(cyclohexylmethyl)-2-methylbenzoate.
| Compound Name | ethyl 4-(1-adamantylmethyl)-3-(pyrimidin-4-ylmethylamino)benzoate;ethyl 5-amino-2-chloro-4-(cyclohexylmethyl)benzoate;ethyl 5-amino-4-(cyclohexylmethyl)-2-methylbenzoate |
|---|---|
| PubChem CID | 161070883 |
| Molecular Formula | C58H78ClN5O6 |
| Molecular Weight | 976.74 g/mol |
| Exact Mass | 975.56 |
| IUPAC Name | ethyl 4-(1-adamantylmethyl)-3-(pyrimidin-4-ylmethylamino)benzoate;ethyl 5-amino-2-chloro-4-(cyclohexylmethyl)benzoate;ethyl 5-amino-4-(cyclohexylmethyl)-2-methylbenzoate |
| SMILES | CCOC(=O)c1cc(N)c(CC2CCCCC2)cc1C.CCOC(=O)c1cc(N)c(CC2CCCCC2)cc1Cl.CCOC(=O)c1ccc(CC23CC4CC(CC(C4)C2)C3)c(NCc2ccncn2)c1 |
| InChI | InChI=1S/C25H31N3O2.C17H25NO2.C16H22ClNO2/c1-2-30-24(29)20-3-4-21(23(10-20)27-15-22-5-6-26-16-28-22)14-25-11-17-7-18(12-25)9-19(8-17)13-25;1-3-20-17(19)15-11-16(18)14(9-12(15)2)10-13-7-5-4-6-8-13;1-2-20-16(19)13-10-15(18)12(9-14(13)17)8-11-6-4-3-5-7-11/h3-6,10,16-19,27H,2,7-9,11-15H2,1H3;9,11,13H,3-8,10,18H2,1-2H3;9-11H,2-8,18H2,1H3 |
| InChIKey | UEQGUDYTJPHQIK-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 168.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 976.74 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|