C29H36B2F3NO8 — CID 161071014
(2-methoxyphenyl)boronic acid;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine;2-phenylmethoxyacetic acid (PubChem CID 161071014) has the molecular formula C29H36B2F3NO8 and a molecular weight of 605.22 g/mol. Its IUPAC name is (2-methoxyphenyl)boronic acid;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine;2-phenylmethoxyacetic acid.
| Compound Name | (2-methoxyphenyl)boronic acid;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine;2-phenylmethoxyacetic acid |
|---|---|
| PubChem CID | 161071014 |
| Molecular Formula | C29H36B2F3NO8 |
| Molecular Weight | 605.22 g/mol |
| Exact Mass | 605.26 |
| IUPAC Name | (2-methoxyphenyl)boronic acid;2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine;2-phenylmethoxyacetic acid |
| SMILES | COc1ccccc1B(O)O.Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(C(F)(F)F)n1.O=C(O)COCc1ccccc1 |
| InChI | InChI=1S/C13H17BF3NO2.C9H10O3.C7H9BO3/c1-8-6-9(7-10(18-8)13(15,16)17)14-19-11(2,3)12(4,5)20-14;10-9(11)7-12-6-8-4-2-1-3-5-8;1-11-7-5-3-2-4-6(7)8(9)10/h6-7H,1-5H3;1-5H,6-7H2,(H,10,11);2-5,9-10H,1H3 |
| InChIKey | UEQRDLLQNJDIFX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.22 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|