About acetyl acetate;1,2-dichloroethane
acetyl acetate;1,2-dichloroethane (PubChem CID 161071038) has the molecular formula C6H10Cl2O3
and a molecular weight of 201.05 g/mol. Its IUPAC name is acetyl acetate;1,2-dichloroethane.
Molecular Properties
| Compound Name | acetyl acetate;1,2-dichloroethane |
| PubChem CID | 161071038 |
| Molecular Formula | C6H10Cl2O3 |
| Molecular Weight | 201.05 g/mol |
| Exact Mass | 200.00 |
| IUPAC Name | acetyl acetate;1,2-dichloroethane |
| SMILES | CC(=O)OC(C)=O.ClCCCl |
| InChI | InChI=1S/C4H6O3.C2H4Cl2/c1-3(5)7-4(2)6;3-1-2-4/h1-2H3;1-2H2 |
| InChIKey | UEQSWUVEGIIJQB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.05 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze acetyl acetate;1,2-dichloroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl acetate;1,2-dichloroethane?
The IUPAC name of acetyl acetate;1,2-dichloroethane (CID 161071038) is acetyl acetate;1,2-dichloroethane.
What is the SMILES notation for acetyl acetate;1,2-dichloroethane?
The canonical SMILES for acetyl acetate;1,2-dichloroethane is CC(=O)OC(C)=O.ClCCCl.
What is the InChIKey of acetyl acetate;1,2-dichloroethane?
The InChIKey is UEQSWUVEGIIJQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3.C2H4Cl2/c1-3(5)7-4(2)6;3-1-2-4/h1-2H3;1-2H2.
What are the key properties of acetyl acetate;1,2-dichloroethane?
acetyl acetate;1,2-dichloroethane has a molecular weight of 201.05 g/mol, XLogP of 1.56, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl acetate;1,2-dichloroethane is sourced from PubChem (CID 161071038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).