C19H15BrF6N4O2 — CID 161071478
1-bromo-4-nitro-2-(trifluoromethyl)benzene;4-(2,4-dimethylimidazol-1-yl)-3-(trifluoromethyl)aniline (PubChem CID 161071478) has the molecular formula C19H15BrF6N4O2 and a molecular weight of 525.25 g/mol. Its IUPAC name is 1-bromo-4-nitro-2-(trifluoromethyl)benzene;4-(2,4-dimethylimidazol-1-yl)-3-(trifluoromethyl)aniline.
| Compound Name | 1-bromo-4-nitro-2-(trifluoromethyl)benzene;4-(2,4-dimethylimidazol-1-yl)-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 161071478 |
| Molecular Formula | C19H15BrF6N4O2 |
| Molecular Weight | 525.25 g/mol |
| Exact Mass | 524.03 |
| IUPAC Name | 1-bromo-4-nitro-2-(trifluoromethyl)benzene;4-(2,4-dimethylimidazol-1-yl)-3-(trifluoromethyl)aniline |
| SMILES | Cc1cn(-c2ccc(N)cc2C(F)(F)F)c(C)n1.O=[N+]([O-])c1ccc(Br)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F3N3.C7H3BrF3NO2/c1-7-6-18(8(2)17-7)11-4-3-9(16)5-10(11)12(13,14)15;8-6-2-1-4(12(13)14)3-5(6)7(9,10)11/h3-6H,16H2,1-2H3;1-3H |
| InChIKey | UESINEUFMSZISV-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.25 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|