C6HNa5O10S6 — CID 161072480
pentasodium;6-sulfanylbenzene-1,2,3,4,5-pentasulfinate (PubChem CID 161072480) has the molecular formula C6HNa5O10S6 and a molecular weight of 540.42 g/mol. Its IUPAC name is pentasodium;6-sulfanylbenzene-1,2,3,4,5-pentasulfinate.
| Compound Name | pentasodium;6-sulfanylbenzene-1,2,3,4,5-pentasulfinate |
|---|---|
| PubChem CID | 161072480 |
| Molecular Formula | C6HNa5O10S6 |
| Molecular Weight | 540.42 g/mol |
| Exact Mass | 539.74 |
| IUPAC Name | pentasodium;6-sulfanylbenzene-1,2,3,4,5-pentasulfinate |
| SMILES | O=S([O-])c1c(S)c(S(=O)[O-])c(S(=O)[O-])c(S(=O)[O-])c1S(=O)[O-].[Na+].[Na+].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C6H6O10S6.5Na/c7-18(8)2-1(17)3(19(9)10)5(21(13)14)6(22(15)16)4(2)20(11)12;;;;;/h17H,(H,7,8)(H,9,10)(H,11,12)(H,13,14)(H,15,16);;;;;/q;5*+1/p-5 |
| InChIKey | UEVMAGDKIVIDRS-UHFFFAOYSA-I |
| XLogP | -16.81 |
| TPSA | 200.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.42 |
| LogP ≤ 5 | -16.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|