C25H26N2O9 — CID 161074405
(1S,18S,19S,20S)-19-ethenyl-18-[(2S,3R,4S,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]oxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-2(11),4,6,8,15-pentaene-10,14-dione (PubChem CID 161074405) has the molecular formula C25H26N2O9 and a molecular weight of 498.49 g/mol. Its IUPAC name is (1S,18S,19S,20S)-19-ethenyl-18-[(2S,3R,4S,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]oxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-2(11),4,6,8,15-pentaene-10,14-dione.
| Compound Name | (1S,18S,19S,20S)-19-ethenyl-18-[(2S,3R,4S,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]oxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-2(11),4,6,8,15-pentaene-10,14-dione |
|---|---|
| PubChem CID | 161074405 |
| Molecular Formula | C25H26N2O9 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | (1S,18S,19S,20S)-19-ethenyl-18-[(2S,3R,4S,5S,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]oxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-2(11),4,6,8,15-pentaene-10,14-dione |
| SMILES | C=C[C@@H]1[C@H](O[C@@H]2O[C@H](O)[C@@H](O)[C@H](O)[C@H]2O)OC=C2C(=O)N3Cc4c([nH]c5ccccc5c4=O)[C@@H]3C[C@H]21 |
| InChI | InChI=1S/C25H26N2O9/c1-2-10-12-7-16-17-13(18(28)11-5-3-4-6-15(11)26-17)8-27(16)22(32)14(12)9-34-24(10)36-25-21(31)19(29)20(30)23(33)35-25/h2-6,9-10,12,16,19-21,23-25,29-31,33H,1,7-8H2,(H,26,28)/t10-,12-,16-,19-,20-,21+,23-,24-,25-/m0/s1 |
| InChIKey | UFBOMADLIBHVPD-YOCPMGRGSA-N |
| XLogP | -0.25 |
| TPSA | 161.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|