About ethane;methyl diphenyl phosphite
ethane;methyl diphenyl phosphite (PubChem CID 161074644) has the molecular formula C17H25O3P
and a molecular weight of 308.36 g/mol. Its IUPAC name is ethane;methyl diphenyl phosphite.
Molecular Properties
| Compound Name | ethane;methyl diphenyl phosphite |
| PubChem CID | 161074644 |
| Molecular Formula | C17H25O3P |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | ethane;methyl diphenyl phosphite |
| SMILES | CC.CC.COP(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C13H13O3P.2C2H6/c1-14-17(15-12-8-4-2-5-9-12)16-13-10-6-3-7-11-13;2*1-2/h2-11H,1H3;2*1-2H3 |
| InChIKey | UFCJHWSJXLOBJO-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl diphenyl phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl diphenyl phosphite?
The IUPAC name of ethane;methyl diphenyl phosphite (CID 161074644) is ethane;methyl diphenyl phosphite.
What is the SMILES notation for ethane;methyl diphenyl phosphite?
The canonical SMILES for ethane;methyl diphenyl phosphite is CC.CC.COP(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of ethane;methyl diphenyl phosphite?
The InChIKey is UFCJHWSJXLOBJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13O3P.2C2H6/c1-14-17(15-12-8-4-2-5-9-12)16-13-10-6-3-7-11-13;2*1-2/h2-11H,1H3;2*1-2H3.
What are the key properties of ethane;methyl diphenyl phosphite?
ethane;methyl diphenyl phosphite has a molecular weight of 308.36 g/mol, XLogP of 6.07, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl diphenyl phosphite is sourced from PubChem (CID 161074644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).