C10H18N4O2 — CID 161075001
N-methylmethanamine;N,N,4-trimethyl-5-nitropyridin-2-amine (PubChem CID 161075001) has the molecular formula C10H18N4O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is N-methylmethanamine;N,N,4-trimethyl-5-nitropyridin-2-amine.
| Compound Name | N-methylmethanamine;N,N,4-trimethyl-5-nitropyridin-2-amine |
|---|---|
| PubChem CID | 161075001 |
| Molecular Formula | C10H18N4O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | N-methylmethanamine;N,N,4-trimethyl-5-nitropyridin-2-amine |
| SMILES | CNC.Cc1cc(N(C)C)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H11N3O2.C2H7N/c1-6-4-8(10(2)3)9-5-7(6)11(12)13;1-3-2/h4-5H,1-3H3;3H,1-2H3 |
| InChIKey | UFDPSCIFNKGJGR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|