About carbon dioxide;ethyl (3R)-2-ethyl-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-nitrobutanoate
carbon dioxide;ethyl (3R)-2-ethyl-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-nitrobutanoate (PubChem CID 161075563) has the molecular formula C14H18F3N3O6
and a molecular weight of 381.31 g/mol. Its IUPAC name is carbon dioxide;ethyl (3R)-2-ethyl-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-nitrobutanoate.
Molecular Properties
| Compound Name | carbon dioxide;ethyl (3R)-2-ethyl-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-nitrobutanoate |
| PubChem CID | 161075563 |
| Molecular Formula | C14H18F3N3O6 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | carbon dioxide;ethyl (3R)-2-ethyl-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-nitrobutanoate |
| SMILES | CCOC(=O)C(CC)[C@H](C[N+](=O)[O-])c1cc(C(F)(F)F)n(C)n1.O=C=O |
| InChI | InChI=1S/C13H18F3N3O4.CO2/c1-4-8(12(20)23-5-2)9(7-19(21)22)10-6-11(13(14,15)16)18(3)17-10;2-1-3/h6,8-9H,4-5,7H2,1-3H3;/t8?,9-;/m0./s1 |
| InChIKey | UFFKKLYUUHQJSW-MTFPJWTKSA-N |
| XLogP | 1.80 |
| TPSA | 121.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze carbon dioxide;ethyl (3R)-2-ethyl-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-nitrobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;ethyl (3R)-2-ethyl-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-nitrobutanoate?
The IUPAC name of carbon dioxide;ethyl (3R)-2-ethyl-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-nitrobutanoate (CID 161075563) is carbon dioxide;ethyl (3R)-2-ethyl-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-nitrobutanoate.
What is the SMILES notation for carbon dioxide;ethyl (3R)-2-ethyl-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-nitrobutanoate?
The canonical SMILES for carbon dioxide;ethyl (3R)-2-ethyl-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-nitrobutanoate is CCOC(=O)C(CC)[C@H](C[N+](=O)[O-])c1cc(C(F)(F)F)n(C)n1.O=C=O.
What is the InChIKey of carbon dioxide;ethyl (3R)-2-ethyl-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-nitrobutanoate?
The InChIKey is UFFKKLYUUHQJSW-MTFPJWTKSA-N. The full InChI is InChI=1S/C13H18F3N3O4.CO2/c1-4-8(12(20)23-5-2)9(7-19(21)22)10-6-11(13(14,15)16)18(3)17-10;2-1-3/h6,8-9H,4-5,7H2,1-3H3;/t8?,9-;/m0./s1.
What are the key properties of carbon dioxide;ethyl (3R)-2-ethyl-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-nitrobutanoate?
carbon dioxide;ethyl (3R)-2-ethyl-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-nitrobutanoate has a molecular weight of 381.31 g/mol, XLogP of 1.80, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;ethyl (3R)-2-ethyl-3-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-4-nitrobutanoate is sourced from PubChem (CID 161075563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).